C49H55N3O3S4 — CID 139260703
5-[5-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde (PubChem CID 139260703) has the molecular formula C49H55N3O3S4 and a molecular weight of 862.27 g/mol. Its IUPAC name is 5-[5-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde.
| Compound Name | 5-[5-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139260703 |
| Molecular Formula | C49H55N3O3S4 |
| Molecular Weight | 862.27 g/mol |
| Exact Mass | 861.31 |
| IUPAC Name | 5-[5-[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-3-octylthiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]-4-octylthiophene-2-carbaldehyde |
| SMILES | CCCCCCCCc1cc(C=O)sc1-c1nc2sc(-c3sc(-c4ccc(N(c5ccc(OC)cc5)c5ccc(OC)cc5)cc4)cc3CCCCCCCC)nc2s1 |
| InChI | InChI=1S/C49H55N3O3S4/c1-5-7-9-11-13-15-17-35-31-42(33-53)56-44(35)46-50-48-49(58-46)51-47(59-48)45-36(18-16-14-12-10-8-6-2)32-43(57-45)34-19-21-37(22-20-34)52(38-23-27-40(54-3)28-24-38)39-25-29-41(55-4)30-26-39/h19-33H,5-18H2,1-4H3 |
| InChIKey | SYNMZXWMJWMELB-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.27 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|