C47H51N3OS4 — CID 139260702
4-octyl-5-[5-[3-octyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophene-2-carbaldehyde (PubChem CID 139260702) has the molecular formula C47H51N3OS4 and a molecular weight of 802.21 g/mol. Its IUPAC name is 4-octyl-5-[5-[3-octyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 4-octyl-5-[5-[3-octyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139260702 |
| Molecular Formula | C47H51N3OS4 |
| Molecular Weight | 802.21 g/mol |
| Exact Mass | 801.29 |
| IUPAC Name | 4-octyl-5-[5-[3-octyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-2-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCCCCCc1cc(C=O)sc1-c1nc2sc(-c3sc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3CCCCCCCC)nc2s1 |
| InChI | InChI=1S/C47H51N3OS4/c1-3-5-7-9-11-15-21-35-31-40(33-51)52-42(35)44-48-46-47(54-44)49-45(55-46)43-36(22-16-12-10-8-6-4-2)32-41(53-43)34-27-29-39(30-28-34)50(37-23-17-13-18-24-37)38-25-19-14-20-26-38/h13-14,17-20,23-33H,3-12,15-16,21-22H2,1-2H3 |
| InChIKey | ITGKERRBRGHGHS-UHFFFAOYSA-N |
| XLogP | 15.97 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.21 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|