C29H38N2OS4 — CID 139260700
4-octyl-5-[2-(3-octylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophene-2-carbaldehyde (PubChem CID 139260700) has the molecular formula C29H38N2OS4 and a molecular weight of 558.90 g/mol. Its IUPAC name is 4-octyl-5-[2-(3-octylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophene-2-carbaldehyde.
| Compound Name | 4-octyl-5-[2-(3-octylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139260700 |
| Molecular Formula | C29H38N2OS4 |
| Molecular Weight | 558.90 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 4-octyl-5-[2-(3-octylthiophen-2-yl)-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCCCCCc1ccsc1-c1nc2sc(-c3sc(C=O)cc3CCCCCCCC)nc2s1 |
| InChI | InChI=1S/C29H38N2OS4/c1-3-5-7-9-11-13-15-21-17-18-33-24(21)26-30-28-29(35-26)31-27(36-28)25-22(19-23(20-32)34-25)16-14-12-10-8-6-4-2/h17-20H,3-16H2,1-2H3 |
| InChIKey | OACHXHFGMCXRSW-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.90 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|