C44H51F2N3O2S3 — CID 172624836
(4-cyano-3,5-difluorophenyl) 11-[4-(dihexylamino)phenyl]-14-(2-ethylhexyl)-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-4-carboxylate (PubChem CID 172624836) has the molecular formula C44H51F2N3O2S3 and a molecular weight of 788.11 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 11-[4-(dihexylamino)phenyl]-14-(2-ethylhexyl)-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-4-carboxylate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 11-[4-(dihexylamino)phenyl]-14-(2-ethylhexyl)-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-4-carboxylate |
|---|---|
| PubChem CID | 172624836 |
| Molecular Formula | C44H51F2N3O2S3 |
| Molecular Weight | 788.11 g/mol |
| Exact Mass | 787.31 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 11-[4-(dihexylamino)phenyl]-14-(2-ethylhexyl)-3,7,10-trithia-14-azatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-4-carboxylate |
| SMILES | CCCCCCN(CCCCCC)c1ccc(-c2cc3c(s2)c2sc4cc(C(=O)Oc5cc(F)c(C#N)c(F)c5)sc4c2n3CC(CC)CCCC)cc1 |
| InChI | InChI=1S/C44H51F2N3O2S3/c1-5-9-12-14-21-48(22-15-13-10-6-2)31-19-17-30(18-20-31)37-25-36-41(52-37)43-40(49(36)28-29(8-4)16-11-7-3)42-38(53-43)26-39(54-42)44(50)51-32-23-34(45)33(27-47)35(46)24-32/h17-20,23-26,29H,5-16,21-22,28H2,1-4H3 |
| InChIKey | WHSOHAFEAGTTHK-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 58.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.11 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|