C52H55N3O4S2 — CID 139594031
2-cyano-3-[10-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid (PubChem CID 139594031) has the molecular formula C52H55N3O4S2 and a molecular weight of 850.16 g/mol. Its IUPAC name is 2-cyano-3-[10-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[10-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139594031 |
| Molecular Formula | C52H55N3O4S2 |
| Molecular Weight | 850.16 g/mol |
| Exact Mass | 849.36 |
| IUPAC Name | 2-cyano-3-[10-[4-[4-(2-ethylhexoxy)-N-[4-(2-ethylhexoxy)phenyl]anilino]phenyl]-7-phenyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]prop-2-enoic acid |
| SMILES | CCCCC(CC)COc1ccc(N(c2ccc(OCC(CC)CCCC)cc2)c2ccc(-c3cc4c(s3)c3sc(C=C(C#N)C(=O)O)cc3n4-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C52H55N3O4S2/c1-5-9-14-36(7-3)34-58-44-26-22-42(23-27-44)54(43-24-28-45(29-25-43)59-35-37(8-4)15-10-6-2)41-20-18-38(19-21-41)49-32-48-51(61-49)50-47(55(48)40-16-12-11-13-17-40)31-46(60-50)30-39(33-53)52(56)57/h11-13,16-32,36-37H,5-10,14-15,34-35H2,1-4H3,(H,56,57) |
| InChIKey | UVDJNGHNURGYTJ-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.16 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|