C16H22OS — CID 102298300
(2S,3aS,7aR)-2-(phenylsulfanylmethyl)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol (PubChem CID 102298300) has the molecular formula C16H22OS and a molecular weight of 262.42 g/mol. Its IUPAC name is (2S,3aS,7aR)-2-(phenylsulfanylmethyl)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol.
| Compound Name | (2S,3aS,7aR)-2-(phenylsulfanylmethyl)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
|---|---|
| PubChem CID | 102298300 |
| Molecular Formula | C16H22OS |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (2S,3aS,7aR)-2-(phenylsulfanylmethyl)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
| SMILES | O[C@]12CCCC[C@@H]1C[C@H](CSc1ccccc1)C2 |
| InChI | InChI=1S/C16H22OS/c17-16-9-5-4-6-14(16)10-13(11-16)12-18-15-7-2-1-3-8-15/h1-3,7-8,13-14,17H,4-6,9-12H2/t13-,14+,16-/m0/s1 |
| InChIKey | PDHTUIHBMFGIOJ-LZWOXQAQSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |