C18H24OS — CID 102298304
(2S,3S,3aR,7aR)-3-ethenyl-2-(phenylsulfanylmethyl)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol (PubChem CID 102298304) has the molecular formula C18H24OS and a molecular weight of 288.46 g/mol. Its IUPAC name is (2S,3S,3aR,7aR)-3-ethenyl-2-(phenylsulfanylmethyl)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol.
| Compound Name | (2S,3S,3aR,7aR)-3-ethenyl-2-(phenylsulfanylmethyl)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
|---|---|
| PubChem CID | 102298304 |
| Molecular Formula | C18H24OS |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (2S,3S,3aR,7aR)-3-ethenyl-2-(phenylsulfanylmethyl)-1,2,3,4,5,6,7,7a-octahydroinden-3a-ol |
| SMILES | C=C[C@H]1[C@@H](CSc2ccccc2)C[C@H]2CCCC[C@@]21O |
| InChI | InChI=1S/C18H24OS/c1-2-17-14(13-20-16-9-4-3-5-10-16)12-15-8-6-7-11-18(15,17)19/h2-5,9-10,14-15,17,19H,1,6-8,11-13H2/t14-,15-,17+,18-/m1/s1 |
| InChIKey | JCBUGIDHBZKHJT-XYVMCAHJSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|