C17H26O4 — CID 102298450
(Z)-4,5,5-triethoxy-1-phenylpent-3-en-1-ol (PubChem CID 102298450) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (Z)-4,5,5-triethoxy-1-phenylpent-3-en-1-ol.
| Compound Name | (Z)-4,5,5-triethoxy-1-phenylpent-3-en-1-ol |
|---|---|
| PubChem CID | 102298450 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (Z)-4,5,5-triethoxy-1-phenylpent-3-en-1-ol |
| SMILES | CCO/C(=C\CC(O)c1ccccc1)C(OCC)OCC |
| InChI | InChI=1S/C17H26O4/c1-4-19-16(17(20-5-2)21-6-3)13-12-15(18)14-10-8-7-9-11-14/h7-11,13,15,17-18H,4-6,12H2,1-3H3/b16-13- |
| InChIKey | LSEXZOVTJXOXDQ-SSZFMOIBSA-N |
| XLogP | 3.43 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|