C10H17FO3 — CID 102299129
(2S,3S,4S)-6-fluoro-4-methoxy-2-methyl-3-prop-2-enoxyoxane (PubChem CID 102299129) has the molecular formula C10H17FO3 and a molecular weight of 204.24 g/mol. Its IUPAC name is (2S,3S,4S)-6-fluoro-4-methoxy-2-methyl-3-prop-2-enoxyoxane.
| Compound Name | (2S,3S,4S)-6-fluoro-4-methoxy-2-methyl-3-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 102299129 |
| Molecular Formula | C10H17FO3 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2S,3S,4S)-6-fluoro-4-methoxy-2-methyl-3-prop-2-enoxyoxane |
| SMILES | C=CCO[C@H]1[C@H](C)OC(F)C[C@@H]1OC |
| InChI | InChI=1S/C10H17FO3/c1-4-5-13-10-7(2)14-9(11)6-8(10)12-3/h4,7-10H,1,5-6H2,2-3H3/t7-,8-,9?,10-/m0/s1 |
| InChIKey | WDTOVUHTQXKICR-HQRIKABESA-N |
| XLogP | 1.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|