C20H32O4 — CID 102302169
methyl (E)-3-[(4R,5R)-4,5-dicyclohexyl-2-methyl-1,3-dioxolan-2-yl]prop-2-enoate (PubChem CID 102302169) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is methyl (E)-3-[(4R,5R)-4,5-dicyclohexyl-2-methyl-1,3-dioxolan-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(4R,5R)-4,5-dicyclohexyl-2-methyl-1,3-dioxolan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102302169 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | methyl (E)-3-[(4R,5R)-4,5-dicyclohexyl-2-methyl-1,3-dioxolan-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1(C)O[C@H](C2CCCCC2)[C@@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C20H32O4/c1-20(14-13-17(21)22-2)23-18(15-9-5-3-6-10-15)19(24-20)16-11-7-4-8-12-16/h13-16,18-19H,3-12H2,1-2H3/b14-13+/t18-,19-/m1/s1 |
| InChIKey | XSHSWZLULJOHEV-WKWPXIAWSA-N |
| XLogP | 4.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|