C31H36N2O6 — CID 10230290
N-(2,3-dihydro-1H-inden-2-yl)-2-[5-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide (PubChem CID 10230290) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-2-[5-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-2-[5-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide |
|---|---|
| PubChem CID | 10230290 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-2-[5-[(3,4-dimethoxyphenyl)methyl]-7,8-dimethoxy-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]acetamide |
| SMILES | COc1ccc(CC2c3cc(OC)c(OC)cc3OCCN2CC(=O)NC2Cc3ccccc3C2)cc1OC |
| InChI | InChI=1S/C31H36N2O6/c1-35-26-10-9-20(14-28(26)36-2)13-25-24-17-29(37-3)30(38-4)18-27(24)39-12-11-33(25)19-31(34)32-23-15-21-7-5-6-8-22(21)16-23/h5-10,14,17-18,23,25H,11-13,15-16,19H2,1-4H3,(H,32,34) |
| InChIKey | ZJZWVHWOXORAAE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |