C32H38N2O6 — CID 22742821
N-(2,3-dihydro-1H-inden-2-yl)-2-[6,7-dimethoxy-1-[(2,3,4-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetamide (PubChem CID 22742821) has the molecular formula C32H38N2O6 and a molecular weight of 546.66 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-2-[6,7-dimethoxy-1-[(2,3,4-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-2-[6,7-dimethoxy-1-[(2,3,4-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetamide |
|---|---|
| PubChem CID | 22742821 |
| Molecular Formula | C32H38N2O6 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-2-[6,7-dimethoxy-1-[(2,3,4-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]acetamide |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(OC)c(OC)c1OC)N(CC(=O)NC1Cc3ccccc3C1)CC2 |
| InChI | InChI=1S/C32H38N2O6/c1-36-27-11-10-23(31(39-4)32(27)40-5)16-26-25-18-29(38-3)28(37-2)17-22(25)12-13-34(26)19-30(35)33-24-14-20-8-6-7-9-21(20)15-24/h6-11,17-18,24,26H,12-16,19H2,1-5H3,(H,33,35) |
| InChIKey | LSOHXJAYVQNUEI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |