C30H66O6Si4 — CID 102304392
(3S,4R,5S)-3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-2-oxohexanal (PubChem CID 102304392) has the molecular formula C30H66O6Si4 and a molecular weight of 635.20 g/mol. Its IUPAC name is (3S,4R,5S)-3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-2-oxohexanal.
| Compound Name | (3S,4R,5S)-3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-2-oxohexanal |
|---|---|
| PubChem CID | 102304392 |
| Molecular Formula | C30H66O6Si4 |
| Molecular Weight | 635.20 g/mol |
| Exact Mass | 634.39 |
| IUPAC Name | (3S,4R,5S)-3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-2-oxohexanal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)C=O |
| InChI | InChI=1S/C30H66O6Si4/c1-27(2,3)37(13,14)33-22-24(34-38(15,16)28(4,5)6)26(36-40(19,20)30(10,11)12)25(23(32)21-31)35-39(17,18)29(7,8)9/h21,24-26H,22H2,1-20H3/t24-,25+,26+/m0/s1 |
| InChIKey | PFNLWMYYYFCWGO-JIMJEQGWSA-N |
| XLogP | 8.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.20 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|