C20H22N2O4 — CID 102304585
tert-butyl N-[(1R)-1-[2-(furan-2-yl)quinolin-4-yl]-2-hydroxyethyl]carbamate (PubChem CID 102304585) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[2-(furan-2-yl)quinolin-4-yl]-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[2-(furan-2-yl)quinolin-4-yl]-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 102304585 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | tert-butyl N-[(1R)-1-[2-(furan-2-yl)quinolin-4-yl]-2-hydroxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C20H22N2O4/c1-20(2,3)26-19(24)22-17(12-23)14-11-16(18-9-6-10-25-18)21-15-8-5-4-7-13(14)15/h4-11,17,23H,12H2,1-3H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | NAPLCIUHADWZBI-KRWDZBQOSA-N |
| XLogP | 4.05 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |