C29H28N2O3 — CID 102304811
3-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-4-(2-phenylethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 102304811) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-4-(2-phenylethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-4-(2-phenylethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 102304811 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-4-(2-phenylethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCCc2ccccc2)c(N2CCC[C@H]2C(O)(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C29H28N2O3/c32-27-25(30-19-18-21-11-4-1-5-12-21)26(28(27)33)31-20-10-17-24(31)29(34,22-13-6-2-7-14-22)23-15-8-3-9-16-23/h1-9,11-16,24,30,34H,10,17-20H2/t24-/m0/s1 |
| InChIKey | BNDXMOIJMLGIDC-DEOSSOPVSA-N |
| XLogP | 3.84 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|