C40H24N2O8S — CID 102305846
2-[4-[4-[4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]phenyl]sulfonylphenoxy]phenyl]isoindole-1,3-dione (PubChem CID 102305846) has the molecular formula C40H24N2O8S and a molecular weight of 692.71 g/mol. Its IUPAC name is 2-[4-[4-[4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]phenyl]sulfonylphenoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]phenyl]sulfonylphenoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102305846 |
| Molecular Formula | C40H24N2O8S |
| Molecular Weight | 692.71 g/mol |
| Exact Mass | 692.13 |
| IUPAC Name | 2-[4-[4-[4-[4-(1,3-dioxoisoindol-2-yl)phenoxy]phenyl]sulfonylphenoxy]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(N5C(=O)c6ccccc6C5=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H24N2O8S/c43-37-33-5-1-2-6-34(33)38(44)41(37)25-9-13-27(14-10-25)49-29-17-21-31(22-18-29)51(47,48)32-23-19-30(20-24-32)50-28-15-11-26(12-16-28)42-39(45)35-7-3-4-8-36(35)40(42)46/h1-24H |
| InChIKey | GQLLHAVXWGIXPM-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.71 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|