C15H24N2Si — CID 102306352
2-phenyl-1,4-di(propan-2-yl)-2,3-dihydro-1,4,2-diazasiline (PubChem CID 102306352) has the molecular formula C15H24N2Si and a molecular weight of 260.46 g/mol. Its IUPAC name is 2-phenyl-1,4-di(propan-2-yl)-2,3-dihydro-1,4,2-diazasiline.
| Compound Name | 2-phenyl-1,4-di(propan-2-yl)-2,3-dihydro-1,4,2-diazasiline |
|---|---|
| PubChem CID | 102306352 |
| Molecular Formula | C15H24N2Si |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-phenyl-1,4-di(propan-2-yl)-2,3-dihydro-1,4,2-diazasiline |
| SMILES | CC(C)N1C=CN(C(C)C)[SiH](c2ccccc2)C1 |
| InChI | InChI=1S/C15H24N2Si/c1-13(2)16-10-11-17(14(3)4)18(12-16)15-8-6-5-7-9-15/h5-11,13-14,18H,12H2,1-4H3 |
| InChIKey | VRTPGWHBIJOGRP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|