C17H28N2Si — CID 135000129
1,4-ditert-butyl-2-phenyl-2,3-dihydro-1,4,2-diazasiline (PubChem CID 135000129) has the molecular formula C17H28N2Si and a molecular weight of 288.51 g/mol. Its IUPAC name is 1,4-ditert-butyl-2-phenyl-2,3-dihydro-1,4,2-diazasiline.
| Compound Name | 1,4-ditert-butyl-2-phenyl-2,3-dihydro-1,4,2-diazasiline |
|---|---|
| PubChem CID | 135000129 |
| Molecular Formula | C17H28N2Si |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 1,4-ditert-butyl-2-phenyl-2,3-dihydro-1,4,2-diazasiline |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)[SiH](c2ccccc2)C1 |
| InChI | InChI=1S/C17H28N2Si/c1-16(2,3)18-12-13-19(17(4,5)6)20(14-18)15-10-8-7-9-11-15/h7-13,20H,14H2,1-6H3 |
| InChIKey | LOJZPGCQRLDWRH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|