C15H24N2Si — CID 134999741
2-phenyl-1,4-dipropyl-2,3-dihydro-1,4,2-diazasiline (PubChem CID 134999741) has the molecular formula C15H24N2Si and a molecular weight of 260.46 g/mol. Its IUPAC name is 2-phenyl-1,4-dipropyl-2,3-dihydro-1,4,2-diazasiline.
| Compound Name | 2-phenyl-1,4-dipropyl-2,3-dihydro-1,4,2-diazasiline |
|---|---|
| PubChem CID | 134999741 |
| Molecular Formula | C15H24N2Si |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-phenyl-1,4-dipropyl-2,3-dihydro-1,4,2-diazasiline |
| SMILES | CCCN1C=CN(CCC)[SiH](c2ccccc2)C1 |
| InChI | InChI=1S/C15H24N2Si/c1-3-10-16-12-13-17(11-4-2)18(14-16)15-8-6-5-7-9-15/h5-9,12-13,18H,3-4,10-11,14H2,1-2H3 |
| InChIKey | GERPQOLKDXFKAK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|