C41H31NO5 — CID 102306631
3,4,10,11-tetrakis(4-methoxyphenyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene-12-carbonitrile (PubChem CID 102306631) has the molecular formula C41H31NO5 and a molecular weight of 617.70 g/mol. Its IUPAC name is 3,4,10,11-tetrakis(4-methoxyphenyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene-12-carbonitrile.
| Compound Name | 3,4,10,11-tetrakis(4-methoxyphenyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene-12-carbonitrile |
|---|---|
| PubChem CID | 102306631 |
| Molecular Formula | C41H31NO5 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | 3,4,10,11-tetrakis(4-methoxyphenyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),3,5,7,9(13),10-hexaene-12-carbonitrile |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)c3cccc4c(-c5ccc(OC)cc5)c(-c5ccc(OC)cc5)c(C#N)c(c34)O2)cc1 |
| InChI | InChI=1S/C41H31NO5/c1-43-29-16-8-25(9-17-29)36-33-6-5-7-34-38(27-12-20-31(45-3)21-13-27)40(28-14-22-32(46-4)23-15-28)47-41(39(33)34)35(24-42)37(36)26-10-18-30(44-2)19-11-26/h5-23H,1-4H3 |
| InChIKey | XTCLXYGUGBWFEB-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|