C8H14BNO2 — CID 102306664
2-buta-1,3-dien-2-yl-1,3,6,2-dioxazaborocane (PubChem CID 102306664) has the molecular formula C8H14BNO2 and a molecular weight of 167.02 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-1,3,6,2-dioxazaborocane.
| Compound Name | 2-buta-1,3-dien-2-yl-1,3,6,2-dioxazaborocane |
|---|---|
| PubChem CID | 102306664 |
| Molecular Formula | C8H14BNO2 |
| Molecular Weight | 167.02 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-1,3,6,2-dioxazaborocane |
| SMILES | C=CC(=C)B1OCCNCCO1 |
| InChI | InChI=1S/C8H14BNO2/c1-3-8(2)9-11-6-4-10-5-7-12-9/h3,10H,1-2,4-7H2 |
| InChIKey | MFCSQVKJPDRNQM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.02 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|