About piperazine;prop-2-enamide
piperazine;prop-2-enamide (PubChem CID 18915240) has the molecular formula C11H25N5O
and a molecular weight of 243.35 g/mol. Its IUPAC name is piperazine;prop-2-enamide.
Molecular Properties
| Compound Name | piperazine;prop-2-enamide |
| PubChem CID | 18915240 |
| Molecular Formula | C11H25N5O |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.21 |
| IUPAC Name | piperazine;prop-2-enamide |
| SMILES | C1CNCCN1.C1CNCCN1.C=CC(N)=O |
| InChI | InChI=1S/2C4H10N2.C3H5NO/c2*1-2-6-4-3-5-1;1-2-3(4)5/h2*5-6H,1-4H2;2H,1H2,(H2,4,5) |
| InChIKey | CCEQAIPWWBTLCL-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze piperazine;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;prop-2-enamide?
The IUPAC name of piperazine;prop-2-enamide (CID 18915240) is piperazine;prop-2-enamide.
What is the SMILES notation for piperazine;prop-2-enamide?
The canonical SMILES for piperazine;prop-2-enamide is C1CNCCN1.C1CNCCN1.C=CC(N)=O.
What is the InChIKey of piperazine;prop-2-enamide?
The InChIKey is CCEQAIPWWBTLCL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H10N2.C3H5NO/c2*1-2-6-4-3-5-1;1-2-3(4)5/h2*5-6H,1-4H2;2H,1H2,(H2,4,5).
What are the key properties of piperazine;prop-2-enamide?
piperazine;prop-2-enamide has a molecular weight of 243.35 g/mol, XLogP of -1.98, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;prop-2-enamide is sourced from PubChem (CID 18915240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).