C23H36N4O11 — CID 10230736
(2R,3R,4S)-3-acetamido-4-[[amino-(1-hexanoyloxyethoxycarbonylamino)methylidene]amino]-2-[(2R,3R,4R)-3,4-dihydroxyoxan-2-yl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 10230736) has the molecular formula C23H36N4O11 and a molecular weight of 544.56 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-[[amino-(1-hexanoyloxyethoxycarbonylamino)methylidene]amino]-2-[(2R,3R,4R)-3,4-dihydroxyoxan-2-yl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-[[amino-(1-hexanoyloxyethoxycarbonylamino)methylidene]amino]-2-[(2R,3R,4R)-3,4-dihydroxyoxan-2-yl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 10230736 |
| Molecular Formula | C23H36N4O11 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-[[amino-(1-hexanoyloxyethoxycarbonylamino)methylidene]amino]-2-[(2R,3R,4R)-3,4-dihydroxyoxan-2-yl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCCCC(=O)OC(C)OC(=O)N/C(N)=N/[C@H]1C=C(C(=O)O)O[C@@H]([C@@H]2OCC[C@@H](O)[C@H]2O)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C23H36N4O11/c1-4-5-6-7-16(30)36-12(3)37-23(34)27-22(24)26-13-10-15(21(32)33)38-19(17(13)25-11(2)28)20-18(31)14(29)8-9-35-20/h10,12-14,17-20,29,31H,4-9H2,1-3H3,(H,25,28)(H,32,33)(H3,24,26,27,34)/t12?,13-,14+,17+,18+,19+,20+/m0/s1 |
| InChIKey | HCZUIKAWOLYNCG-BOTZDSMOSA-N |
| XLogP | -0.75 |
| TPSA | 228.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|