C16H26N4O6 — CID 141256881
(3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[hydroxy-(2-hydroxycyclohexyl)methyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 141256881) has the molecular formula C16H26N4O6 and a molecular weight of 370.41 g/mol. Its IUPAC name is (3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[hydroxy-(2-hydroxycyclohexyl)methyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[hydroxy-(2-hydroxycyclohexyl)methyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 141256881 |
| Molecular Formula | C16H26N4O6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-[hydroxy-(2-hydroxycyclohexyl)methyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@H]1C(C(O)C2CCCCC2O)OC(C(=O)O)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C16H26N4O6/c1-7(21)19-12-9(20-16(17)18)6-11(15(24)25)26-14(12)13(23)8-4-2-3-5-10(8)22/h6,8-10,12-14,22-23H,2-5H2,1H3,(H,19,21)(H,24,25)(H4,17,18,20)/t8?,9-,10?,12+,13?,14?/m0/s1 |
| InChIKey | ICXLNSNEWCZFBG-KHQCGNEZSA-N |
| XLogP | -1.59 |
| TPSA | 180.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|