C22H39N7O7 — CID 11168220
(2R,3R,4S)-3-acetamido-2-[(1R,2R)-1-(10-azidodecoxy)-2,3-dihydroxypropyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 11168220) has the molecular formula C22H39N7O7 and a molecular weight of 513.60 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-2-[(1R,2R)-1-(10-azidodecoxy)-2,3-dihydroxypropyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-2-[(1R,2R)-1-(10-azidodecoxy)-2,3-dihydroxypropyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 11168220 |
| Molecular Formula | C22H39N7O7 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-2-[(1R,2R)-1-(10-azidodecoxy)-2,3-dihydroxypropyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](OCCCCCCCCCCN=[N+]=[N-])[C@H](O)CO)OC(C(=O)O)=C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C22H39N7O7/c1-14(31)27-18-15(28-22(23)24)12-17(21(33)34)36-20(18)19(16(32)13-30)35-11-9-7-5-3-2-4-6-8-10-26-29-25/h12,15-16,18-20,30,32H,2-11,13H2,1H3,(H,27,31)(H,33,34)(H4,23,24,28)/t15-,16+,18+,19+,20+/m0/s1 |
| InChIKey | NYCVDSKJJFHUTK-APQLOABGSA-N |
| XLogP | 0.67 |
| TPSA | 238.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|