C17H31N5O5 — CID 5275966
(3S,4R)-3-acetamido-2-[(R)-[butan-2-yl(propyl)amino]-hydroxymethyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 5275966) has the molecular formula C17H31N5O5 and a molecular weight of 385.47 g/mol. Its IUPAC name is (3S,4R)-3-acetamido-2-[(R)-[butan-2-yl(propyl)amino]-hydroxymethyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (3S,4R)-3-acetamido-2-[(R)-[butan-2-yl(propyl)amino]-hydroxymethyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 5275966 |
| Molecular Formula | C17H31N5O5 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (3S,4R)-3-acetamido-2-[(R)-[butan-2-yl(propyl)amino]-hydroxymethyl]-4-(diaminomethylideneamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCN(C(C)CC)[C@H](O)C1OC(C(=O)O)=C[C@@H](N=C(N)N)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C17H31N5O5/c1-5-7-22(9(3)6-2)15(24)14-13(20-10(4)23)11(21-17(18)19)8-12(27-14)16(25)26/h8-9,11,13-15,24H,5-7H2,1-4H3,(H,20,23)(H,25,26)(H4,18,19,21)/t9?,11-,13+,14?,15-/m1/s1 |
| InChIKey | SEEFZLPDSKYLMS-VGBHATHXSA-N |
| XLogP | -0.67 |
| TPSA | 163.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|