C18H33N2O+ — CID 102307378
1-(1-butyl-3-methylimidazol-3-ium-2-yl)-3,7-dimethyloct-6-en-3-ol (PubChem CID 102307378) has the molecular formula C18H33N2O+ and a molecular weight of 293.48 g/mol. Its IUPAC name is 1-(1-butyl-3-methylimidazol-3-ium-2-yl)-3,7-dimethyloct-6-en-3-ol.
| Compound Name | 1-(1-butyl-3-methylimidazol-3-ium-2-yl)-3,7-dimethyloct-6-en-3-ol |
|---|---|
| PubChem CID | 102307378 |
| Molecular Formula | C18H33N2O+ |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | 1-(1-butyl-3-methylimidazol-3-ium-2-yl)-3,7-dimethyloct-6-en-3-ol |
| SMILES | CCCCn1cc[n+](C)c1CCC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C18H33N2O/c1-6-7-13-20-15-14-19(5)17(20)10-12-18(4,21)11-8-9-16(2)3/h9,14-15,21H,6-8,10-13H2,1-5H3/q+1 |
| InChIKey | HCMVZACEJZENFT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|