C19H32N2O2 — CID 139677218
3,7,11-trimethyl-1-(2-methylimidazol-1-yl)dodeca-6,10-diene-2,3-diol (PubChem CID 139677218) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 3,7,11-trimethyl-1-(2-methylimidazol-1-yl)dodeca-6,10-diene-2,3-diol.
| Compound Name | 3,7,11-trimethyl-1-(2-methylimidazol-1-yl)dodeca-6,10-diene-2,3-diol |
|---|---|
| PubChem CID | 139677218 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 3,7,11-trimethyl-1-(2-methylimidazol-1-yl)dodeca-6,10-diene-2,3-diol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)(O)C(O)Cn1ccnc1C |
| InChI | InChI=1S/C19H32N2O2/c1-15(2)8-6-9-16(3)10-7-11-19(5,23)18(22)14-21-13-12-20-17(21)4/h8,10,12-13,18,22-23H,6-7,9,11,14H2,1-5H3 |
| InChIKey | HSBYLVJGAMXZLP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|