C24H46N2O2 — CID 139677213
3,7,11,15-tetramethyl-1-(2-methylimidazol-1-yl)hexadecane-2,3-diol (PubChem CID 139677213) has the molecular formula C24H46N2O2 and a molecular weight of 394.64 g/mol. Its IUPAC name is 3,7,11,15-tetramethyl-1-(2-methylimidazol-1-yl)hexadecane-2,3-diol.
| Compound Name | 3,7,11,15-tetramethyl-1-(2-methylimidazol-1-yl)hexadecane-2,3-diol |
|---|---|
| PubChem CID | 139677213 |
| Molecular Formula | C24H46N2O2 |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.36 |
| IUPAC Name | 3,7,11,15-tetramethyl-1-(2-methylimidazol-1-yl)hexadecane-2,3-diol |
| SMILES | Cc1nccn1CC(O)C(C)(O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C24H46N2O2/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-24(6,28)23(27)18-26-17-16-25-22(26)5/h16-17,19-21,23,27-28H,7-15,18H2,1-6H3 |
| InChIKey | IUMWQUGGQRALLJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |