C18H35N3O — CID 92861407
(6S)-8-[3-(2-ethylimidazol-1-yl)propylamino]-2,6-dimethyloctan-2-ol (PubChem CID 92861407) has the molecular formula C18H35N3O and a molecular weight of 309.50 g/mol. Its IUPAC name is (6S)-8-[3-(2-ethylimidazol-1-yl)propylamino]-2,6-dimethyloctan-2-ol.
| Compound Name | (6S)-8-[3-(2-ethylimidazol-1-yl)propylamino]-2,6-dimethyloctan-2-ol |
|---|---|
| PubChem CID | 92861407 |
| Molecular Formula | C18H35N3O |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.28 |
| IUPAC Name | (6S)-8-[3-(2-ethylimidazol-1-yl)propylamino]-2,6-dimethyloctan-2-ol |
| SMILES | CCc1nccn1CCCNCC[C@@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C18H35N3O/c1-5-17-20-13-15-21(17)14-7-11-19-12-9-16(2)8-6-10-18(3,4)22/h13,15-16,19,22H,5-12,14H2,1-4H3/t16-/m0/s1 |
| InChIKey | QORSAQWPOBECGU-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|