C19H36N2O3 — CID 139677219
1-[2-(hydroxymethyl)imidazol-1-yl]-3,7,11-trimethyldodecane-2,3-diol (PubChem CID 139677219) has the molecular formula C19H36N2O3 and a molecular weight of 340.51 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)imidazol-1-yl]-3,7,11-trimethyldodecane-2,3-diol.
| Compound Name | 1-[2-(hydroxymethyl)imidazol-1-yl]-3,7,11-trimethyldodecane-2,3-diol |
|---|---|
| PubChem CID | 139677219 |
| Molecular Formula | C19H36N2O3 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.27 |
| IUPAC Name | 1-[2-(hydroxymethyl)imidazol-1-yl]-3,7,11-trimethyldodecane-2,3-diol |
| SMILES | CC(C)CCCC(C)CCCC(C)(O)C(O)Cn1ccnc1CO |
| InChI | InChI=1S/C19H36N2O3/c1-15(2)7-5-8-16(3)9-6-10-19(4,24)17(23)13-21-12-11-20-18(21)14-22/h11-12,15-17,22-24H,5-10,13-14H2,1-4H3 |
| InChIKey | JWHXTAXRVKAGGM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |