C14H20N2O — CID 134837468
3,7-dimethyl-1-(1-methylimidazol-2-yl)oct-6-en-1-yn-3-ol (PubChem CID 134837468) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3,7-dimethyl-1-(1-methylimidazol-2-yl)oct-6-en-1-yn-3-ol.
| Compound Name | 3,7-dimethyl-1-(1-methylimidazol-2-yl)oct-6-en-1-yn-3-ol |
|---|---|
| PubChem CID | 134837468 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3,7-dimethyl-1-(1-methylimidazol-2-yl)oct-6-en-1-yn-3-ol |
| SMILES | CC(C)=CCCC(C)(O)C#Cc1nccn1C |
| InChI | InChI=1S/C14H20N2O/c1-12(2)6-5-8-14(3,17)9-7-13-15-10-11-16(13)4/h6,10-11,17H,5,8H2,1-4H3 |
| InChIKey | RQNFOEDDCPSDBK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|