C12H20N2O — CID 175867863
(E)-8-imidazol-1-yl-2-methyloct-4-en-1-ol (PubChem CID 175867863) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is (E)-8-imidazol-1-yl-2-methyloct-4-en-1-ol.
| Compound Name | (E)-8-imidazol-1-yl-2-methyloct-4-en-1-ol |
|---|---|
| PubChem CID | 175867863 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (E)-8-imidazol-1-yl-2-methyloct-4-en-1-ol |
| SMILES | CC(CO)C/C=C/CCCn1ccnc1 |
| InChI | InChI=1S/C12H20N2O/c1-12(10-15)6-4-2-3-5-8-14-9-7-13-11-14/h2,4,7,9,11-12,15H,3,5-6,8,10H2,1H3/b4-2+ |
| InChIKey | SXSMOYNGGAWZAA-DUXPYHPUSA-N |
| XLogP | 2.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|