C35H42N4O5 — CID 102307449
2,2-diethyl-15,18,21,24,27-pentaoxa-8,34,39,40-tetrazapentacyclo[34.2.1.13,6.09,14.028,33]tetraconta-1(38),3,5,7,9,11,13,28,30,32,34,36-dodecaene (PubChem CID 102307449) has the molecular formula C35H42N4O5 and a molecular weight of 598.74 g/mol. Its IUPAC name is 2,2-diethyl-15,18,21,24,27-pentaoxa-8,34,39,40-tetrazapentacyclo[34.2.1.13,6.09,14.028,33]tetraconta-1(38),3,5,7,9,11,13,28,30,32,34,36-dodecaene.
| Compound Name | 2,2-diethyl-15,18,21,24,27-pentaoxa-8,34,39,40-tetrazapentacyclo[34.2.1.13,6.09,14.028,33]tetraconta-1(38),3,5,7,9,11,13,28,30,32,34,36-dodecaene |
|---|---|
| PubChem CID | 102307449 |
| Molecular Formula | C35H42N4O5 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | 2,2-diethyl-15,18,21,24,27-pentaoxa-8,34,39,40-tetrazapentacyclo[34.2.1.13,6.09,14.028,33]tetraconta-1(38),3,5,7,9,11,13,28,30,32,34,36-dodecaene |
| SMILES | CCC1(CC)c2ccc([nH]2)/C=N\c2ccccc2OCCOCCOCCOCCOc2ccccc2/N=C/c2ccc1[nH]2 |
| InChI | InChI=1S/C35H42N4O5/c1-3-35(4-2)33-15-13-27(38-33)25-36-29-9-5-7-11-31(29)43-23-21-41-19-17-40-18-20-42-22-24-44-32-12-8-6-10-30(32)37-26-28-14-16-34(35)39-28/h5-16,25-26,38-39H,3-4,17-24H2,1-2H3/b36-25-,37-26+ |
| InChIKey | WGMBYGYIQPTQFY-BZFHFVERSA-N |
| XLogP | 6.77 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |