C17H17N3O — CID 102307731
5-(4-methoxyphenyl)-2,3,5,6-tetrahydroimidazo[1,2-c]quinazoline (PubChem CID 102307731) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2,3,5,6-tetrahydroimidazo[1,2-c]quinazoline.
| Compound Name | 5-(4-methoxyphenyl)-2,3,5,6-tetrahydroimidazo[1,2-c]quinazoline |
|---|---|
| PubChem CID | 102307731 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-2,3,5,6-tetrahydroimidazo[1,2-c]quinazoline |
| SMILES | COc1ccc(C2Nc3ccccc3C3=NCCN32)cc1 |
| InChI | InChI=1S/C17H17N3O/c1-21-13-8-6-12(7-9-13)16-19-15-5-3-2-4-14(15)17-18-10-11-20(16)17/h2-9,16,19H,10-11H2,1H3 |
| InChIKey | DWFWZLIUBOPKQH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |