C17H17N3 — CID 154269156
6-phenyl-3,4,6,7-tetrahydro-2H-pyrimido[1,2-c]quinazoline (PubChem CID 154269156) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-phenyl-3,4,6,7-tetrahydro-2H-pyrimido[1,2-c]quinazoline.
| Compound Name | 6-phenyl-3,4,6,7-tetrahydro-2H-pyrimido[1,2-c]quinazoline |
|---|---|
| PubChem CID | 154269156 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 6-phenyl-3,4,6,7-tetrahydro-2H-pyrimido[1,2-c]quinazoline |
| SMILES | c1ccc(C2Nc3ccccc3C3=NCCCN32)cc1 |
| InChI | InChI=1S/C17H17N3/c1-2-7-13(8-3-1)16-19-15-10-5-4-9-14(15)17-18-11-6-12-20(16)17/h1-5,7-10,16,19H,6,11-12H2 |
| InChIKey | QOFMPGBTFIWZLE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |