C19H20N2O5 — CID 102308322
(2R,3S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-(3-nitrophenyl)oxirane-2-carboxamide (PubChem CID 102308322) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2R,3S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-(3-nitrophenyl)oxirane-2-carboxamide.
| Compound Name | (2R,3S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-(3-nitrophenyl)oxirane-2-carboxamide |
|---|---|
| PubChem CID | 102308322 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2R,3S)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-(3-nitrophenyl)oxirane-2-carboxamide |
| SMILES | C[C@@H]([C@@H](O)c1ccccc1)N(C)C(=O)[C@@H]1O[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N2O5/c1-12(16(22)13-7-4-3-5-8-13)20(2)19(23)18-17(26-18)14-9-6-10-15(11-14)21(24)25/h3-12,16-18,22H,1-2H3/t12-,16+,17-,18+/m0/s1 |
| InChIKey | UBYDAONGJWFWJQ-PSMGESJCSA-N |
| XLogP | 2.62 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|