C13H17FO3 — CID 102310473
ethyl 6-fluoro-3-oxo-2,4,5,6,7,8-hexahydro-1H-azulene-2-carboxylate (PubChem CID 102310473) has the molecular formula C13H17FO3 and a molecular weight of 240.27 g/mol. Its IUPAC name is ethyl 6-fluoro-3-oxo-2,4,5,6,7,8-hexahydro-1H-azulene-2-carboxylate.
| Compound Name | ethyl 6-fluoro-3-oxo-2,4,5,6,7,8-hexahydro-1H-azulene-2-carboxylate |
|---|---|
| PubChem CID | 102310473 |
| Molecular Formula | C13H17FO3 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | ethyl 6-fluoro-3-oxo-2,4,5,6,7,8-hexahydro-1H-azulene-2-carboxylate |
| SMILES | CCOC(=O)C1CC2=C(CCC(F)CC2)C1=O |
| InChI | InChI=1S/C13H17FO3/c1-2-17-13(16)11-7-8-3-4-9(14)5-6-10(8)12(11)15/h9,11H,2-7H2,1H3 |
| InChIKey | VIZSTCOMDQCVSP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|