C21H25NO — CID 102310578
trans-(1R,2S)-2-(benzylamino)-1-[(E)-2-phenylethenyl]cyclohexan-1-ol (PubChem CID 102310578) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is trans-(1R,2S)-2-(benzylamino)-1-[(E)-2-phenylethenyl]cyclohexan-1-ol.
| Compound Name | trans-(1R,2S)-2-(benzylamino)-1-[(E)-2-phenylethenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102310578 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | trans-(1R,2S)-2-(benzylamino)-1-[(E)-2-phenylethenyl]cyclohexan-1-ol |
| SMILES | O[C@@]1(/C=C/c2ccccc2)CCCC[C@@H]1NCc1ccccc1 |
| InChI | InChI=1S/C21H25NO/c23-21(16-14-18-9-3-1-4-10-18)15-8-7-13-20(21)22-17-19-11-5-2-6-12-19/h1-6,9-12,14,16,20,22-23H,7-8,13,15,17H2/b16-14+/t20-,21+/m0/s1 |
| InChIKey | VFPKDQGHEBGGKH-ODOOKIQISA-N |
| XLogP | 4.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |