C35H56O6 — CID 102313546
(2S)-3-[4-[3-[4-[(2S)-2-hydroxy-3-methyl-3-octoxybutoxy]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]propane-1,2-diol (PubChem CID 102313546) has the molecular formula C35H56O6 and a molecular weight of 572.83 g/mol. Its IUPAC name is (2S)-3-[4-[3-[4-[(2S)-2-hydroxy-3-methyl-3-octoxybutoxy]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]propane-1,2-diol.
| Compound Name | (2S)-3-[4-[3-[4-[(2S)-2-hydroxy-3-methyl-3-octoxybutoxy]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 102313546 |
| Molecular Formula | C35H56O6 |
| Molecular Weight | 572.83 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | (2S)-3-[4-[3-[4-[(2S)-2-hydroxy-3-methyl-3-octoxybutoxy]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]propane-1,2-diol |
| SMILES | CCCCCCCCOC(C)(C)[C@@H](O)COc1ccc(C(CC)(CC)c2ccc(OC[C@@H](O)CO)c(C)c2)cc1C |
| InChI | InChI=1S/C35H56O6/c1-8-11-12-13-14-15-20-41-34(6,7)33(38)25-40-32-19-17-29(22-27(32)5)35(9-2,10-3)28-16-18-31(26(4)21-28)39-24-30(37)23-36/h16-19,21-22,30,33,36-38H,8-15,20,23-25H2,1-7H3/t30-,33-/m0/s1 |
| InChIKey | CNYUNQUMBHDYBO-DITALETJSA-N |
| XLogP | 7.04 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.83 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|