C22H36NO9P — CID 102314767
N-[(1R)-1-[(4R,5S)-5-[(1R)-1-dimethoxyphosphoryl-2-phenylmethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethoxyethyl]acetamide (PubChem CID 102314767) has the molecular formula C22H36NO9P and a molecular weight of 489.50 g/mol. Its IUPAC name is N-[(1R)-1-[(4R,5S)-5-[(1R)-1-dimethoxyphosphoryl-2-phenylmethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethoxyethyl]acetamide.
| Compound Name | N-[(1R)-1-[(4R,5S)-5-[(1R)-1-dimethoxyphosphoryl-2-phenylmethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethoxyethyl]acetamide |
|---|---|
| PubChem CID | 102314767 |
| Molecular Formula | C22H36NO9P |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-[(1R)-1-[(4R,5S)-5-[(1R)-1-dimethoxyphosphoryl-2-phenylmethoxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethoxyethyl]acetamide |
| SMILES | COC(OC)[C@H](NC(C)=O)[C@H]1OC(C)(C)O[C@@H]1[C@@H](COCc1ccccc1)P(=O)(OC)OC |
| InChI | InChI=1S/C22H36NO9P/c1-15(24)23-18(21(26-4)27-5)20-19(31-22(2,3)32-20)17(33(25,28-6)29-7)14-30-13-16-11-9-8-10-12-16/h8-12,17-21H,13-14H2,1-7H3,(H,23,24)/t17-,18-,19-,20-/m1/s1 |
| InChIKey | SFNIAEPHMOGAGK-UAFMIMERSA-N |
| XLogP | 2.70 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|