C15H13NO4 — CID 102315169
(3R)-3-[(2S)-2-methyl-5-oxofuran-2-yl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 102315169) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is (3R)-3-[(2S)-2-methyl-5-oxofuran-2-yl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(2S)-2-methyl-5-oxofuran-2-yl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 102315169 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (3R)-3-[(2S)-2-methyl-5-oxofuran-2-yl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | C[C@@]1([C@H]2CC(=O)N(c3ccccc3)C2=O)C=CC(=O)O1 |
| InChI | InChI=1S/C15H13NO4/c1-15(8-7-13(18)20-15)11-9-12(17)16(14(11)19)10-5-3-2-4-6-10/h2-8,11H,9H2,1H3/t11-,15-/m0/s1 |
| InChIKey | FTOZFQMWLHVRPZ-NHYWBVRUSA-N |
| XLogP | 1.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|