C29H30N2O4 — CID 155807592
(3aS,4R,5S,7aS)-5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4,7-diethyl-5-methyl-2-phenyl-4,7a-dihydro-3aH-isoindole-1,3-dione (PubChem CID 155807592) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is (3aS,4R,5S,7aS)-5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4,7-diethyl-5-methyl-2-phenyl-4,7a-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | (3aS,4R,5S,7aS)-5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4,7-diethyl-5-methyl-2-phenyl-4,7a-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 155807592 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | (3aS,4R,5S,7aS)-5-(2,5-dioxo-1-phenylpyrrolidin-3-yl)-4,7-diethyl-5-methyl-2-phenyl-4,7a-dihydro-3aH-isoindole-1,3-dione |
| SMILES | CCC1=C[C@@](C)(C2CC(=O)N(c3ccccc3)C2=O)[C@H](CC)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C29H30N2O4/c1-4-18-17-29(3,22-16-23(32)30(26(22)33)19-12-8-6-9-13-19)21(5-2)25-24(18)27(34)31(28(25)35)20-14-10-7-11-15-20/h6-15,17,21-22,24-25H,4-5,16H2,1-3H3/t21-,22?,24-,25+,29-/m1/s1 |
| InChIKey | HTGOEYXNWVMJIB-BZFCIAOOSA-N |
| XLogP | 4.75 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|