C15H29IO3Si — CID 102319320
(6R,8R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-iodooxocan-2-one (PubChem CID 102319320) has the molecular formula C15H29IO3Si and a molecular weight of 412.38 g/mol. Its IUPAC name is (6R,8R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-iodooxocan-2-one.
| Compound Name | (6R,8R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-iodooxocan-2-one |
|---|---|
| PubChem CID | 102319320 |
| Molecular Formula | C15H29IO3Si |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (6R,8R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-iodooxocan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1C[C@H](I)CCCC(=O)O1 |
| InChI | InChI=1S/C15H29IO3Si/c1-15(2,3)20(4,5)18-10-9-13-11-12(16)7-6-8-14(17)19-13/h12-13H,6-11H2,1-5H3/t12-,13-/m1/s1 |
| InChIKey | RVKIDASCZBEFQX-CHWSQXEVSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|