C19H40O3Si2 — CID 101251160
(3aS,4S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-trimethylsilyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-7a-ol (PubChem CID 101251160) has the molecular formula C19H40O3Si2 and a molecular weight of 372.70 g/mol. Its IUPAC name is (3aS,4S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-trimethylsilyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-7a-ol.
| Compound Name | (3aS,4S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-trimethylsilyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-7a-ol |
|---|---|
| PubChem CID | 101251160 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (3aS,4S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-trimethylsilyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-7a-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1C[C@@H]2[C@@H]([Si](C)(C)C)CCCC2(O)O1 |
| InChI | InChI=1S/C19H40O3Si2/c1-18(2,3)24(7,8)21-13-11-15-14-16-17(23(4,5)6)10-9-12-19(16,20)22-15/h15-17,20H,9-14H2,1-8H3/t15?,16-,17+,19?/m1/s1 |
| InChIKey | DELIMQAYVONAQU-ISXWCOSWSA-N |
| XLogP | 5.38 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|