C23H30NO2Se+ — CID 102320488
methyl 2-[(2R)-5,5-dimethyl-2-(phenylselanylmethyl)piperidin-1-ium-1-yl]-2-phenylacetate (PubChem CID 102320488) has the molecular formula C23H30NO2Se+ and a molecular weight of 431.46 g/mol. Its IUPAC name is methyl 2-[(2R)-5,5-dimethyl-2-(phenylselanylmethyl)piperidin-1-ium-1-yl]-2-phenylacetate.
| Compound Name | methyl 2-[(2R)-5,5-dimethyl-2-(phenylselanylmethyl)piperidin-1-ium-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 102320488 |
| Molecular Formula | C23H30NO2Se+ |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | methyl 2-[(2R)-5,5-dimethyl-2-(phenylselanylmethyl)piperidin-1-ium-1-yl]-2-phenylacetate |
| SMILES | COC(=O)C(c1ccccc1)[NH+]1CC(C)(C)CC[C@@H]1C[Se]c1ccccc1 |
| InChI | InChI=1S/C23H29NO2Se/c1-23(2)15-14-19(16-27-20-12-8-5-9-13-20)24(17-23)21(22(25)26-3)18-10-6-4-7-11-18/h4-13,19,21H,14-17H2,1-3H3/p+1/t19-,21?/m1/s1 |
| InChIKey | ATAVEDZSMPEWJR-YMBRHYMPSA-O |
| XLogP | 2.42 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|