C17H22O2Se — CID 139265845
methyl 2-[(1S)-cyclohex-2-en-1-yl]-4-phenylselanylbutanoate (PubChem CID 139265845) has the molecular formula C17H22O2Se and a molecular weight of 337.32 g/mol. Its IUPAC name is methyl 2-[(1S)-cyclohex-2-en-1-yl]-4-phenylselanylbutanoate.
| Compound Name | methyl 2-[(1S)-cyclohex-2-en-1-yl]-4-phenylselanylbutanoate |
|---|---|
| PubChem CID | 139265845 |
| Molecular Formula | C17H22O2Se |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | methyl 2-[(1S)-cyclohex-2-en-1-yl]-4-phenylselanylbutanoate |
| SMILES | COC(=O)C(CC[Se]c1ccccc1)[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C17H22O2Se/c1-19-17(18)16(14-8-4-2-5-9-14)12-13-20-15-10-6-3-7-11-15/h3-4,6-8,10-11,14,16H,2,5,9,12-13H2,1H3/t14-,16?/m1/s1 |
| InChIKey | MWOODDNDJYCSRZ-IURRXHLWSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|