C12F23N — CID 10232280
1-[1,2,2,3,3,4,5,5,6,6-decafluoro-4-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,5,5-heptafluoro-4-(trifluoromethyl)pyrrolidine (PubChem CID 10232280) has the molecular formula C12F23N and a molecular weight of 595.09 g/mol. Its IUPAC name is 1-[1,2,2,3,3,4,5,5,6,6-decafluoro-4-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,5,5-heptafluoro-4-(trifluoromethyl)pyrrolidine.
| Compound Name | 1-[1,2,2,3,3,4,5,5,6,6-decafluoro-4-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,5,5-heptafluoro-4-(trifluoromethyl)pyrrolidine |
|---|---|
| PubChem CID | 10232280 |
| Molecular Formula | C12F23N |
| Molecular Weight | 595.09 g/mol |
| Exact Mass | 594.97 |
| IUPAC Name | 1-[1,2,2,3,3,4,5,5,6,6-decafluoro-4-(trifluoromethyl)cyclohexyl]-2,2,3,3,4,5,5-heptafluoro-4-(trifluoromethyl)pyrrolidine |
| SMILES | FC(F)(F)C1(F)C(F)(F)N(C2(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C2(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12F23N/c13-1(9(26,27)28)3(15,16)6(21,22)8(25,7(23,24)4(1,17)18)36-11(32,33)2(14,10(29,30)31)5(19,20)12(36,34)35 |
| InChIKey | NZQPVKZALLSUOZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.09 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|