C12H17NO4 — CID 102322917
ethyl 7-nitro-2,3,3a,6,7,7a-hexahydro-1H-indene-5-carboxylate (PubChem CID 102322917) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is ethyl 7-nitro-2,3,3a,6,7,7a-hexahydro-1H-indene-5-carboxylate.
| Compound Name | ethyl 7-nitro-2,3,3a,6,7,7a-hexahydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 102322917 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | ethyl 7-nitro-2,3,3a,6,7,7a-hexahydro-1H-indene-5-carboxylate |
| SMILES | CCOC(=O)C1=CC2CCCC2C([N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H17NO4/c1-2-17-12(14)9-6-8-4-3-5-10(8)11(7-9)13(15)16/h6,8,10-11H,2-5,7H2,1H3 |
| InChIKey | WVMGFJLPEREKOU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|