C25H36O15S — CID 102323107
[(2R,3R,4S,5R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 102323107) has the molecular formula C25H36O15S and a molecular weight of 608.62 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102323107 |
| Molecular Formula | C25H36O15S |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4-diacetyloxy-6-ethylsulfanyl-5-[(2S,3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CCS[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1O[C@@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H36O15S/c1-8-41-25-23(21(37-15(6)30)19(35-13(4)28)18(39-25)9-32-11(2)26)40-24-22(38-16(7)31)20(36-14(5)29)17(10-33-24)34-12(3)27/h17-25H,8-10H2,1-7H3/t17-,18-,19-,20+,21+,22-,23-,24+,25+/m1/s1 |
| InChIKey | GOLKDFKEYQMHKG-PXFGZLCVSA-N |
| XLogP | 0.43 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|